C17H17NO3S — CID 10470972
methyl (2S,3R)-1-(4-methylphenyl)sulfinyl-3-phenylaziridine-2-carboxylate (PubChem CID 10470972) has the molecular formula C17H17NO3S and a molecular weight of 315.39 g/mol. Its IUPAC name is methyl (2S,3R)-1-(4-methylphenyl)sulfinyl-3-phenylaziridine-2-carboxylate.
| Compound Name | methyl (2S,3R)-1-(4-methylphenyl)sulfinyl-3-phenylaziridine-2-carboxylate |
|---|---|
| PubChem CID | 10470972 |
| Molecular Formula | C17H17NO3S |
| Molecular Weight | 315.39 g/mol |
| Exact Mass | 315.09 |
| IUPAC Name | methyl (2S,3R)-1-(4-methylphenyl)sulfinyl-3-phenylaziridine-2-carboxylate |
| SMILES | COC(=O)[C@@H]1[C@@H](c2ccccc2)N1S(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C17H17NO3S/c1-12-8-10-14(11-9-12)22(20)18-15(16(18)17(19)21-2)13-6-4-3-5-7-13/h3-11,15-16H,1-2H3/t15-,16+,18?,22?/m1/s1 |
| InChIKey | UMPUHHVBBMHJPU-ASJKOTLKSA-N |
| XLogP | 2.62 |
| TPSA | 46.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.39 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|