C19H18FNO5S — CID 102487263
ethyl 2-(4-fluorobenzoyl)-1-(4-methylphenyl)sulfonylaziridine-2-carboxylate (PubChem CID 102487263) has the molecular formula C19H18FNO5S and a molecular weight of 391.42 g/mol. Its IUPAC name is ethyl 2-(4-fluorobenzoyl)-1-(4-methylphenyl)sulfonylaziridine-2-carboxylate.
| Compound Name | ethyl 2-(4-fluorobenzoyl)-1-(4-methylphenyl)sulfonylaziridine-2-carboxylate |
|---|---|
| PubChem CID | 102487263 |
| Molecular Formula | C19H18FNO5S |
| Molecular Weight | 391.42 g/mol |
| Exact Mass | 391.09 |
| IUPAC Name | ethyl 2-(4-fluorobenzoyl)-1-(4-methylphenyl)sulfonylaziridine-2-carboxylate |
| SMILES | CCOC(=O)C1(C(=O)c2ccc(F)cc2)CN1S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C19H18FNO5S/c1-3-26-18(23)19(17(22)14-6-8-15(20)9-7-14)12-21(19)27(24,25)16-10-4-13(2)5-11-16/h4-11H,3,12H2,1-2H3 |
| InChIKey | FLBVPPHAHIORGO-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 80.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.42 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|