C30H28FNO7S — CID 134954871
diethyl (3R)-4-benzoyl-5-fluoro-1-(4-methylphenyl)sulfonyl-3-phenyl-3H-pyrrole-2,2-dicarboxylate (PubChem CID 134954871) has the molecular formula C30H28FNO7S and a molecular weight of 565.62 g/mol. Its IUPAC name is diethyl (3R)-4-benzoyl-5-fluoro-1-(4-methylphenyl)sulfonyl-3-phenyl-3H-pyrrole-2,2-dicarboxylate.
| Compound Name | diethyl (3R)-4-benzoyl-5-fluoro-1-(4-methylphenyl)sulfonyl-3-phenyl-3H-pyrrole-2,2-dicarboxylate |
|---|---|
| PubChem CID | 134954871 |
| Molecular Formula | C30H28FNO7S |
| Molecular Weight | 565.62 g/mol |
| Exact Mass | 565.16 |
| IUPAC Name | diethyl (3R)-4-benzoyl-5-fluoro-1-(4-methylphenyl)sulfonyl-3-phenyl-3H-pyrrole-2,2-dicarboxylate |
| SMILES | CCOC(=O)C1(C(=O)OCC)[C@H](c2ccccc2)C(C(=O)c2ccccc2)=C(F)N1S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C30H28FNO7S/c1-4-38-28(34)30(29(35)39-5-2)25(21-12-8-6-9-13-21)24(26(33)22-14-10-7-11-15-22)27(31)32(30)40(36,37)23-18-16-20(3)17-19-23/h6-19,25H,4-5H2,1-3H3/t25-/m1/s1 |
| InChIKey | XRIMQJIZNWVBPU-RUZDIDTESA-N |
| XLogP | 4.71 |
| TPSA | 107.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.62 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|