C29H29NO7S — CID 71697118
diethyl (3R,4S)-4-benzoyl-1-(4-methylphenyl)sulfonyl-3-phenylazetidine-2,2-dicarboxylate (PubChem CID 71697118) has the molecular formula C29H29NO7S and a molecular weight of 535.62 g/mol. Its IUPAC name is diethyl (3R,4S)-4-benzoyl-1-(4-methylphenyl)sulfonyl-3-phenylazetidine-2,2-dicarboxylate.
| Compound Name | diethyl (3R,4S)-4-benzoyl-1-(4-methylphenyl)sulfonyl-3-phenylazetidine-2,2-dicarboxylate |
|---|---|
| PubChem CID | 71697118 |
| Molecular Formula | C29H29NO7S |
| Molecular Weight | 535.62 g/mol |
| Exact Mass | 535.17 |
| IUPAC Name | diethyl (3R,4S)-4-benzoyl-1-(4-methylphenyl)sulfonyl-3-phenylazetidine-2,2-dicarboxylate |
| SMILES | CCOC(=O)C1(C(=O)OCC)[C@H](c2ccccc2)[C@@H](C(=O)c2ccccc2)N1S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C29H29NO7S/c1-4-36-27(32)29(28(33)37-5-2)24(21-12-8-6-9-13-21)25(26(31)22-14-10-7-11-15-22)30(29)38(34,35)23-18-16-20(3)17-19-23/h6-19,24-25H,4-5H2,1-3H3/t24-,25+/m1/s1 |
| InChIKey | JTNOECOBWJSALL-RPBOFIJWSA-N |
| XLogP | 3.90 |
| TPSA | 107.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.62 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|