C25H25NO5S — CID 102195408
methyl (3S,4S)-4-[(4-methylphenyl)sulfonylamino]-5-oxo-3,5-diphenylpentanoate (PubChem CID 102195408) has the molecular formula C25H25NO5S and a molecular weight of 451.54 g/mol. Its IUPAC name is methyl (3S,4S)-4-[(4-methylphenyl)sulfonylamino]-5-oxo-3,5-diphenylpentanoate.
| Compound Name | methyl (3S,4S)-4-[(4-methylphenyl)sulfonylamino]-5-oxo-3,5-diphenylpentanoate |
|---|---|
| PubChem CID | 102195408 |
| Molecular Formula | C25H25NO5S |
| Molecular Weight | 451.54 g/mol |
| Exact Mass | 451.15 |
| IUPAC Name | methyl (3S,4S)-4-[(4-methylphenyl)sulfonylamino]-5-oxo-3,5-diphenylpentanoate |
| SMILES | COC(=O)C[C@@H](c1ccccc1)[C@H](NS(=O)(=O)c1ccc(C)cc1)C(=O)c1ccccc1 |
| InChI | InChI=1S/C25H25NO5S/c1-18-13-15-21(16-14-18)32(29,30)26-24(25(28)20-11-7-4-8-12-20)22(17-23(27)31-2)19-9-5-3-6-10-19/h3-16,22,24,26H,17H2,1-2H3/t22-,24-/m0/s1 |
| InChIKey | FLIFZOQJQHJIJJ-UPVQGACJSA-N |
| XLogP | 3.87 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.54 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |