C25H26FNO7S — CID 134854445
diethyl 4-acetyl-5-fluoro-1-(4-methylphenyl)sulfonyl-3-phenyl-3H-pyrrole-2,2-dicarboxylate (PubChem CID 134854445) has the molecular formula C25H26FNO7S and a molecular weight of 503.55 g/mol. Its IUPAC name is diethyl 4-acetyl-5-fluoro-1-(4-methylphenyl)sulfonyl-3-phenyl-3H-pyrrole-2,2-dicarboxylate.
| Compound Name | diethyl 4-acetyl-5-fluoro-1-(4-methylphenyl)sulfonyl-3-phenyl-3H-pyrrole-2,2-dicarboxylate |
|---|---|
| PubChem CID | 134854445 |
| Molecular Formula | C25H26FNO7S |
| Molecular Weight | 503.55 g/mol |
| Exact Mass | 503.14 |
| IUPAC Name | diethyl 4-acetyl-5-fluoro-1-(4-methylphenyl)sulfonyl-3-phenyl-3H-pyrrole-2,2-dicarboxylate |
| SMILES | CCOC(=O)C1(C(=O)OCC)C(c2ccccc2)C(C(C)=O)=C(F)N1S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C25H26FNO7S/c1-5-33-23(29)25(24(30)34-6-2)21(18-10-8-7-9-11-18)20(17(4)28)22(26)27(25)35(31,32)19-14-12-16(3)13-15-19/h7-15,21H,5-6H2,1-4H3 |
| InChIKey | HMVNXFBNTSTYGT-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 107.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.55 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|