C26H27ClFNO8S — CID 132529413
triethyl 3-(2-chlorophenyl)-5-fluoro-1-(4-methylphenyl)sulfonyl-3H-pyrrole-2,2,4-tricarboxylate (PubChem CID 132529413) has the molecular formula C26H27ClFNO8S and a molecular weight of 568.02 g/mol. Its IUPAC name is triethyl 3-(2-chlorophenyl)-5-fluoro-1-(4-methylphenyl)sulfonyl-3H-pyrrole-2,2,4-tricarboxylate.
| Compound Name | triethyl 3-(2-chlorophenyl)-5-fluoro-1-(4-methylphenyl)sulfonyl-3H-pyrrole-2,2,4-tricarboxylate |
|---|---|
| PubChem CID | 132529413 |
| Molecular Formula | C26H27ClFNO8S |
| Molecular Weight | 568.02 g/mol |
| Exact Mass | 567.11 |
| IUPAC Name | triethyl 3-(2-chlorophenyl)-5-fluoro-1-(4-methylphenyl)sulfonyl-3H-pyrrole-2,2,4-tricarboxylate |
| SMILES | CCOC(=O)C1=C(F)N(S(=O)(=O)c2ccc(C)cc2)C(C(=O)OCC)(C(=O)OCC)C1c1ccccc1Cl |
| InChI | InChI=1S/C26H27ClFNO8S/c1-5-35-23(30)20-21(18-10-8-9-11-19(18)27)26(24(31)36-6-2,25(32)37-7-3)29(22(20)28)38(33,34)17-14-12-16(4)13-15-17/h8-15,21H,5-7H2,1-4H3 |
| InChIKey | BWOVJNVBDMSPTM-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 116.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.02 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|