C15H16BrN3 — CID 116898658
N-[[4-(5-bromo-2-methylphenyl)pyrimidin-2-yl]methyl]cyclopropanamine (PubChem CID 116898658) has the molecular formula C15H16BrN3 and a molecular weight of 318.22 g/mol. Its IUPAC name is N-[[4-(5-bromo-2-methylphenyl)pyrimidin-2-yl]methyl]cyclopropanamine.
| Compound Name | N-[[4-(5-bromo-2-methylphenyl)pyrimidin-2-yl]methyl]cyclopropanamine |
|---|---|
| PubChem CID | 116898658 |
| Molecular Formula | C15H16BrN3 |
| Molecular Weight | 318.22 g/mol |
| Exact Mass | 317.05 |
| IUPAC Name | N-[[4-(5-bromo-2-methylphenyl)pyrimidin-2-yl]methyl]cyclopropanamine |
| SMILES | Cc1ccc(Br)cc1-c1ccnc(CNC2CC2)n1 |
| InChI | InChI=1S/C15H16BrN3/c1-10-2-3-11(16)8-13(10)14-6-7-17-15(19-14)9-18-12-4-5-12/h2-3,6-8,12,18H,4-5,9H2,1H3 |
| InChIKey | HPAUTVAZELSPAY-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.22 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |