C9H11N3O2 — CID 84664586
2-[(cyclopropylamino)methyl]pyrimidine-4-carboxylic acid (PubChem CID 84664586) has the molecular formula C9H11N3O2 and a molecular weight of 193.21 g/mol. Its IUPAC name is 2-[(cyclopropylamino)methyl]pyrimidine-4-carboxylic acid.
| Compound Name | 2-[(cyclopropylamino)methyl]pyrimidine-4-carboxylic acid |
|---|---|
| PubChem CID | 84664586 |
| Molecular Formula | C9H11N3O2 |
| Molecular Weight | 193.21 g/mol |
| Exact Mass | 193.09 |
| IUPAC Name | 2-[(cyclopropylamino)methyl]pyrimidine-4-carboxylic acid |
| SMILES | O=C(O)c1ccnc(CNC2CC2)n1 |
| InChI | InChI=1S/C9H11N3O2/c13-9(14)7-3-4-10-8(12-7)5-11-6-1-2-6/h3-4,6,11H,1-2,5H2,(H,13,14) |
| InChIKey | CHQPMMOJQLUQIQ-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 75.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.21 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |