C14H13N3 — CID 116900946
2-[4-(3,4-dimethylphenyl)pyrimidin-2-yl]acetonitrile (PubChem CID 116900946) has the molecular formula C14H13N3 and a molecular weight of 223.28 g/mol. Its IUPAC name is 2-[4-(3,4-dimethylphenyl)pyrimidin-2-yl]acetonitrile.
| Compound Name | 2-[4-(3,4-dimethylphenyl)pyrimidin-2-yl]acetonitrile |
|---|---|
| PubChem CID | 116900946 |
| Molecular Formula | C14H13N3 |
| Molecular Weight | 223.28 g/mol |
| Exact Mass | 223.11 |
| IUPAC Name | 2-[4-(3,4-dimethylphenyl)pyrimidin-2-yl]acetonitrile |
| SMILES | Cc1ccc(-c2ccnc(CC#N)n2)cc1C |
| InChI | InChI=1S/C14H13N3/c1-10-3-4-12(9-11(10)2)13-6-8-16-14(17-13)5-7-15/h3-4,6,8-9H,5H2,1-2H3 |
| InChIKey | ZQGMQQSVYUJAEJ-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 49.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.28 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |