C18H17FN6O3S — CID 11690197
N-(4-fluoro-2-nitrophenyl)-2-[1-(2,4,6-trimethylphenyl)tetrazol-5-yl]sulfanylacetamide (PubChem CID 11690197) has the molecular formula C18H17FN6O3S and a molecular weight of 416.44 g/mol. Its IUPAC name is N-(4-fluoro-2-nitrophenyl)-2-[1-(2,4,6-trimethylphenyl)tetrazol-5-yl]sulfanylacetamide.
| Compound Name | N-(4-fluoro-2-nitrophenyl)-2-[1-(2,4,6-trimethylphenyl)tetrazol-5-yl]sulfanylacetamide |
|---|---|
| PubChem CID | 11690197 |
| Molecular Formula | C18H17FN6O3S |
| Molecular Weight | 416.44 g/mol |
| Exact Mass | 416.11 |
| IUPAC Name | N-(4-fluoro-2-nitrophenyl)-2-[1-(2,4,6-trimethylphenyl)tetrazol-5-yl]sulfanylacetamide |
| SMILES | Cc1cc(C)c(-n2nnnc2SCC(=O)Nc2ccc(F)cc2[N+](=O)[O-])c(C)c1 |
| InChI | InChI=1S/C18H17FN6O3S/c1-10-6-11(2)17(12(3)7-10)24-18(21-22-23-24)29-9-16(26)20-14-5-4-13(19)8-15(14)25(27)28/h4-8H,9H2,1-3H3,(H,20,26) |
| InChIKey | FQAHERPLZMNUEK-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 115.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.44 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|