C16H24N2O — CID 116905700
1-(1-benzofuran-3-yl)-N,N,2,2-tetramethylbutane-1,4-diamine (PubChem CID 116905700) has the molecular formula C16H24N2O and a molecular weight of 260.38 g/mol. Its IUPAC name is 1-(1-benzofuran-3-yl)-N,N,2,2-tetramethylbutane-1,4-diamine.
| Compound Name | 1-(1-benzofuran-3-yl)-N,N,2,2-tetramethylbutane-1,4-diamine |
|---|---|
| PubChem CID | 116905700 |
| Molecular Formula | C16H24N2O |
| Molecular Weight | 260.38 g/mol |
| Exact Mass | 260.19 |
| IUPAC Name | 1-(1-benzofuran-3-yl)-N,N,2,2-tetramethylbutane-1,4-diamine |
| SMILES | CN(C)C(c1coc2ccccc12)C(C)(C)CCN |
| InChI | InChI=1S/C16H24N2O/c1-16(2,9-10-17)15(18(3)4)13-11-19-14-8-6-5-7-12(13)14/h5-8,11,15H,9-10,17H2,1-4H3 |
| InChIKey | KVGFFWYBWSRAMK-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 42.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.38 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |