C9H19ClN2 — CID 116907508
2-chloro-N,N-dimethyl-1-(1-methylpyrrolidin-3-yl)ethanamine (PubChem CID 116907508) has the molecular formula C9H19ClN2 and a molecular weight of 190.72 g/mol. Its IUPAC name is 2-chloro-N,N-dimethyl-1-(1-methylpyrrolidin-3-yl)ethanamine.
| Compound Name | 2-chloro-N,N-dimethyl-1-(1-methylpyrrolidin-3-yl)ethanamine |
|---|---|
| PubChem CID | 116907508 |
| Molecular Formula | C9H19ClN2 |
| Molecular Weight | 190.72 g/mol |
| Exact Mass | 190.12 |
| IUPAC Name | 2-chloro-N,N-dimethyl-1-(1-methylpyrrolidin-3-yl)ethanamine |
| SMILES | CN1CCC(C(CCl)N(C)C)C1 |
| InChI | InChI=1S/C9H19ClN2/c1-11(2)9(6-10)8-4-5-12(3)7-8/h8-9H,4-7H2,1-3H3 |
| InChIKey | QHFDEEKBEYBHOH-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.72 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|