C9H18ClNO — CID 116907498
2-chloro-N,N-dimethyl-1-(oxan-4-yl)ethanamine (PubChem CID 116907498) has the molecular formula C9H18ClNO and a molecular weight of 191.70 g/mol. Its IUPAC name is 2-chloro-N,N-dimethyl-1-(oxan-4-yl)ethanamine.
| Compound Name | 2-chloro-N,N-dimethyl-1-(oxan-4-yl)ethanamine |
|---|---|
| PubChem CID | 116907498 |
| Molecular Formula | C9H18ClNO |
| Molecular Weight | 191.70 g/mol |
| Exact Mass | 191.11 |
| IUPAC Name | 2-chloro-N,N-dimethyl-1-(oxan-4-yl)ethanamine |
| SMILES | CN(C)C(CCl)C1CCOCC1 |
| InChI | InChI=1S/C9H18ClNO/c1-11(2)9(7-10)8-3-5-12-6-4-8/h8-9H,3-7H2,1-2H3 |
| InChIKey | LCEUEIQYBBLLCE-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.70 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|