C13H28N2O — CID 116905772
N,N,3,3-tetramethyl-1-(oxan-4-yl)butane-1,4-diamine (PubChem CID 116905772) has the molecular formula C13H28N2O and a molecular weight of 228.38 g/mol. Its IUPAC name is N,N,3,3-tetramethyl-1-(oxan-4-yl)butane-1,4-diamine.
| Compound Name | N,N,3,3-tetramethyl-1-(oxan-4-yl)butane-1,4-diamine |
|---|---|
| PubChem CID | 116905772 |
| Molecular Formula | C13H28N2O |
| Molecular Weight | 228.38 g/mol |
| Exact Mass | 228.22 |
| IUPAC Name | N,N,3,3-tetramethyl-1-(oxan-4-yl)butane-1,4-diamine |
| SMILES | CN(C)C(CC(C)(C)CN)C1CCOCC1 |
| InChI | InChI=1S/C13H28N2O/c1-13(2,10-14)9-12(15(3)4)11-5-7-16-8-6-11/h11-12H,5-10,14H2,1-4H3 |
| InChIKey | YWKKWKFGSUUINS-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.38 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |