C11H24N2O — CID 116904749
N,N,2-trimethyl-1-(oxan-4-yl)propane-1,3-diamine (PubChem CID 116904749) has the molecular formula C11H24N2O and a molecular weight of 200.33 g/mol. Its IUPAC name is N,N,2-trimethyl-1-(oxan-4-yl)propane-1,3-diamine.
| Compound Name | N,N,2-trimethyl-1-(oxan-4-yl)propane-1,3-diamine |
|---|---|
| PubChem CID | 116904749 |
| Molecular Formula | C11H24N2O |
| Molecular Weight | 200.33 g/mol |
| Exact Mass | 200.19 |
| IUPAC Name | N,N,2-trimethyl-1-(oxan-4-yl)propane-1,3-diamine |
| SMILES | CC(CN)C(C1CCOCC1)N(C)C |
| InChI | InChI=1S/C11H24N2O/c1-9(8-12)11(13(2)3)10-4-6-14-7-5-10/h9-11H,4-8,12H2,1-3H3 |
| InChIKey | XSEXTGQZEYWACK-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.33 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |