C15H25NS — CID 116908941
3-(dimethylamino)-3-(2,3,5,6-tetramethylphenyl)propane-1-thiol (PubChem CID 116908941) has the molecular formula C15H25NS and a molecular weight of 251.44 g/mol. Its IUPAC name is 3-(dimethylamino)-3-(2,3,5,6-tetramethylphenyl)propane-1-thiol.
| Compound Name | 3-(dimethylamino)-3-(2,3,5,6-tetramethylphenyl)propane-1-thiol |
|---|---|
| PubChem CID | 116908941 |
| Molecular Formula | C15H25NS |
| Molecular Weight | 251.44 g/mol |
| Exact Mass | 251.17 |
| IUPAC Name | 3-(dimethylamino)-3-(2,3,5,6-tetramethylphenyl)propane-1-thiol |
| SMILES | Cc1cc(C)c(C)c(C(CCS)N(C)C)c1C |
| InChI | InChI=1S/C15H25NS/c1-10-9-11(2)13(4)15(12(10)3)14(7-8-17)16(5)6/h9,14,17H,7-8H2,1-6H3 |
| InChIKey | ZZRJGFFWOKTAEB-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 3.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.44 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|