C13H20ClN — CID 116937694
3-chloro-1-(2,3,5,6-tetramethylphenyl)propan-1-amine (PubChem CID 116937694) has the molecular formula C13H20ClN and a molecular weight of 225.76 g/mol. Its IUPAC name is 3-chloro-1-(2,3,5,6-tetramethylphenyl)propan-1-amine.
| Compound Name | 3-chloro-1-(2,3,5,6-tetramethylphenyl)propan-1-amine |
|---|---|
| PubChem CID | 116937694 |
| Molecular Formula | C13H20ClN |
| Molecular Weight | 225.76 g/mol |
| Exact Mass | 225.13 |
| IUPAC Name | 3-chloro-1-(2,3,5,6-tetramethylphenyl)propan-1-amine |
| SMILES | Cc1cc(C)c(C)c(C(N)CCCl)c1C |
| InChI | InChI=1S/C13H20ClN/c1-8-7-9(2)11(4)13(10(8)3)12(15)5-6-14/h7,12H,5-6,15H2,1-4H3 |
| InChIKey | NFUJOPIKKYYHRY-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.76 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|