C14H20BrNO — CID 116912694
[1-[(3-bromophenyl)-(dimethylamino)methyl]cyclobutyl]methanol (PubChem CID 116912694) has the molecular formula C14H20BrNO and a molecular weight of 298.22 g/mol. Its IUPAC name is [1-[(3-bromophenyl)-(dimethylamino)methyl]cyclobutyl]methanol.
| Compound Name | [1-[(3-bromophenyl)-(dimethylamino)methyl]cyclobutyl]methanol |
|---|---|
| PubChem CID | 116912694 |
| Molecular Formula | C14H20BrNO |
| Molecular Weight | 298.22 g/mol |
| Exact Mass | 297.07 |
| IUPAC Name | [1-[(3-bromophenyl)-(dimethylamino)methyl]cyclobutyl]methanol |
| SMILES | CN(C)C(c1cccc(Br)c1)C1(CO)CCC1 |
| InChI | InChI=1S/C14H20BrNO/c1-16(2)13(14(10-17)7-4-8-14)11-5-3-6-12(15)9-11/h3,5-6,9,13,17H,4,7-8,10H2,1-2H3 |
| InChIKey | PTHRFPBNCZLFIT-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.22 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |