C12H16BrNO2 — CID 116910238
methyl 3-(3-bromophenyl)-3-(dimethylamino)propanoate (PubChem CID 116910238) has the molecular formula C12H16BrNO2 and a molecular weight of 286.17 g/mol. Its IUPAC name is methyl 3-(3-bromophenyl)-3-(dimethylamino)propanoate.
| Compound Name | methyl 3-(3-bromophenyl)-3-(dimethylamino)propanoate |
|---|---|
| PubChem CID | 116910238 |
| Molecular Formula | C12H16BrNO2 |
| Molecular Weight | 286.17 g/mol |
| Exact Mass | 285.04 |
| IUPAC Name | methyl 3-(3-bromophenyl)-3-(dimethylamino)propanoate |
| SMILES | COC(=O)CC(c1cccc(Br)c1)N(C)C |
| InChI | InChI=1S/C12H16BrNO2/c1-14(2)11(8-12(15)16-3)9-5-4-6-10(13)7-9/h4-7,11H,8H2,1-3H3 |
| InChIKey | ZMEFBFDZLWEVDA-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.17 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |