C15H22BrClN2O4 — CID 119750810
methyl 3-(3-bromophenyl)-3-[[2-(2-methoxyethylamino)acetyl]amino]propanoate;hydrochloride (PubChem CID 119750810) has the molecular formula C15H22BrClN2O4 and a molecular weight of 409.71 g/mol. Its IUPAC name is methyl 3-(3-bromophenyl)-3-[[2-(2-methoxyethylamino)acetyl]amino]propanoate;hydrochloride.
| Compound Name | methyl 3-(3-bromophenyl)-3-[[2-(2-methoxyethylamino)acetyl]amino]propanoate;hydrochloride |
|---|---|
| PubChem CID | 119750810 |
| Molecular Formula | C15H22BrClN2O4 |
| Molecular Weight | 409.71 g/mol |
| Exact Mass | 408.05 |
| IUPAC Name | methyl 3-(3-bromophenyl)-3-[[2-(2-methoxyethylamino)acetyl]amino]propanoate;hydrochloride |
| SMILES | COCCNCC(=O)NC(CC(=O)OC)c1cccc(Br)c1.Cl |
| InChI | InChI=1S/C15H21BrN2O4.ClH/c1-21-7-6-17-10-14(19)18-13(9-15(20)22-2)11-4-3-5-12(16)8-11;/h3-5,8,13,17H,6-7,9-10H2,1-2H3,(H,18,19);1H |
| InChIKey | QHTUIZOWNACHEQ-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.71 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|