C14H19BrN2O4 — CID 120987190
methyl 3-[(2-amino-3-methoxypropanoyl)amino]-3-(3-bromophenyl)propanoate (PubChem CID 120987190) has the molecular formula C14H19BrN2O4 and a molecular weight of 359.22 g/mol. Its IUPAC name is methyl 3-[(2-amino-3-methoxypropanoyl)amino]-3-(3-bromophenyl)propanoate.
| Compound Name | methyl 3-[(2-amino-3-methoxypropanoyl)amino]-3-(3-bromophenyl)propanoate |
|---|---|
| PubChem CID | 120987190 |
| Molecular Formula | C14H19BrN2O4 |
| Molecular Weight | 359.22 g/mol |
| Exact Mass | 358.05 |
| IUPAC Name | methyl 3-[(2-amino-3-methoxypropanoyl)amino]-3-(3-bromophenyl)propanoate |
| SMILES | COCC(N)C(=O)NC(CC(=O)OC)c1cccc(Br)c1 |
| InChI | InChI=1S/C14H19BrN2O4/c1-20-8-11(16)14(19)17-12(7-13(18)21-2)9-4-3-5-10(15)6-9/h3-6,11-12H,7-8,16H2,1-2H3,(H,17,19) |
| InChIKey | JXLVCNJSEIWHGK-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.22 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |