C21H20BrN3O3 — CID 60568769
methyl 3-(3-bromophenyl)-3-[(5-methyl-1-phenylpyrazole-4-carbonyl)amino]propanoate (PubChem CID 60568769) has the molecular formula C21H20BrN3O3 and a molecular weight of 442.31 g/mol. Its IUPAC name is methyl 3-(3-bromophenyl)-3-[(5-methyl-1-phenylpyrazole-4-carbonyl)amino]propanoate.
| Compound Name | methyl 3-(3-bromophenyl)-3-[(5-methyl-1-phenylpyrazole-4-carbonyl)amino]propanoate |
|---|---|
| PubChem CID | 60568769 |
| Molecular Formula | C21H20BrN3O3 |
| Molecular Weight | 442.31 g/mol |
| Exact Mass | 441.07 |
| IUPAC Name | methyl 3-(3-bromophenyl)-3-[(5-methyl-1-phenylpyrazole-4-carbonyl)amino]propanoate |
| SMILES | COC(=O)CC(NC(=O)c1cnn(-c2ccccc2)c1C)c1cccc(Br)c1 |
| InChI | InChI=1S/C21H20BrN3O3/c1-14-18(13-23-25(14)17-9-4-3-5-10-17)21(27)24-19(12-20(26)28-2)15-7-6-8-16(22)11-15/h3-11,13,19H,12H2,1-2H3,(H,24,27) |
| InChIKey | XTXKAFVCNCZEIQ-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.31 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |