C20H20N4O3 — CID 47062002
methyl 3-[(5-methyl-1-phenyltriazole-4-carbonyl)amino]-3-phenylpropanoate (PubChem CID 47062002) has the molecular formula C20H20N4O3 and a molecular weight of 364.41 g/mol. Its IUPAC name is methyl 3-[(5-methyl-1-phenyltriazole-4-carbonyl)amino]-3-phenylpropanoate.
| Compound Name | methyl 3-[(5-methyl-1-phenyltriazole-4-carbonyl)amino]-3-phenylpropanoate |
|---|---|
| PubChem CID | 47062002 |
| Molecular Formula | C20H20N4O3 |
| Molecular Weight | 364.41 g/mol |
| Exact Mass | 364.15 |
| IUPAC Name | methyl 3-[(5-methyl-1-phenyltriazole-4-carbonyl)amino]-3-phenylpropanoate |
| SMILES | COC(=O)CC(NC(=O)c1nnn(-c2ccccc2)c1C)c1ccccc1 |
| InChI | InChI=1S/C20H20N4O3/c1-14-19(22-23-24(14)16-11-7-4-8-12-16)20(26)21-17(13-18(25)27-2)15-9-5-3-6-10-15/h3-12,17H,13H2,1-2H3,(H,21,26) |
| InChIKey | ZDXUJNMMGYZDQX-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 86.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.41 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |