C23H19BrN4O — CID 46554617
1-(4-bromophenyl)-5-methyl-N-[phenyl(pyridin-2-yl)methyl]pyrazole-4-carboxamide (PubChem CID 46554617) has the molecular formula C23H19BrN4O and a molecular weight of 447.34 g/mol. Its IUPAC name is 1-(4-bromophenyl)-5-methyl-N-[phenyl(pyridin-2-yl)methyl]pyrazole-4-carboxamide.
| Compound Name | 1-(4-bromophenyl)-5-methyl-N-[phenyl(pyridin-2-yl)methyl]pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 46554617 |
| Molecular Formula | C23H19BrN4O |
| Molecular Weight | 447.34 g/mol |
| Exact Mass | 446.07 |
| IUPAC Name | 1-(4-bromophenyl)-5-methyl-N-[phenyl(pyridin-2-yl)methyl]pyrazole-4-carboxamide |
| SMILES | Cc1c(C(=O)NC(c2ccccc2)c2ccccn2)cnn1-c1ccc(Br)cc1 |
| InChI | InChI=1S/C23H19BrN4O/c1-16-20(15-26-28(16)19-12-10-18(24)11-13-19)23(29)27-22(17-7-3-2-4-8-17)21-9-5-6-14-25-21/h2-15,22H,1H3,(H,27,29) |
| InChIKey | BODSFBALIOWFIS-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.34 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |