C20H19BrN4O3 — CID 60572248
1-(4-bromophenyl)-N-[2-[(2-hydroxybenzoyl)amino]ethyl]-5-methylpyrazole-4-carboxamide (PubChem CID 60572248) has the molecular formula C20H19BrN4O3 and a molecular weight of 443.30 g/mol. Its IUPAC name is 1-(4-bromophenyl)-N-[2-[(2-hydroxybenzoyl)amino]ethyl]-5-methylpyrazole-4-carboxamide.
| Compound Name | 1-(4-bromophenyl)-N-[2-[(2-hydroxybenzoyl)amino]ethyl]-5-methylpyrazole-4-carboxamide |
|---|---|
| PubChem CID | 60572248 |
| Molecular Formula | C20H19BrN4O3 |
| Molecular Weight | 443.30 g/mol |
| Exact Mass | 442.06 |
| IUPAC Name | 1-(4-bromophenyl)-N-[2-[(2-hydroxybenzoyl)amino]ethyl]-5-methylpyrazole-4-carboxamide |
| SMILES | Cc1c(C(=O)NCCNC(=O)c2ccccc2O)cnn1-c1ccc(Br)cc1 |
| InChI | InChI=1S/C20H19BrN4O3/c1-13-17(12-24-25(13)15-8-6-14(21)7-9-15)20(28)23-11-10-22-19(27)16-4-2-3-5-18(16)26/h2-9,12,26H,10-11H2,1H3,(H,22,27)(H,23,28) |
| InChIKey | PZBYVXOIEQAVSB-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 96.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.30 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|