C19H23BrN4O2 — CID 55803274
1-(4-bromophenyl)-5-methyl-N-(3-oxo-3-piperidin-1-ylpropyl)pyrazole-4-carboxamide (PubChem CID 55803274) has the molecular formula C19H23BrN4O2 and a molecular weight of 419.32 g/mol. Its IUPAC name is 1-(4-bromophenyl)-5-methyl-N-(3-oxo-3-piperidin-1-ylpropyl)pyrazole-4-carboxamide.
| Compound Name | 1-(4-bromophenyl)-5-methyl-N-(3-oxo-3-piperidin-1-ylpropyl)pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 55803274 |
| Molecular Formula | C19H23BrN4O2 |
| Molecular Weight | 419.32 g/mol |
| Exact Mass | 418.10 |
| IUPAC Name | 1-(4-bromophenyl)-5-methyl-N-(3-oxo-3-piperidin-1-ylpropyl)pyrazole-4-carboxamide |
| SMILES | Cc1c(C(=O)NCCC(=O)N2CCCCC2)cnn1-c1ccc(Br)cc1 |
| InChI | InChI=1S/C19H23BrN4O2/c1-14-17(13-22-24(14)16-7-5-15(20)6-8-16)19(26)21-10-9-18(25)23-11-3-2-4-12-23/h5-8,13H,2-4,9-12H2,1H3,(H,21,26) |
| InChIKey | XGXHGOQMCHAPTC-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.32 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |