C17H24N2O4 — CID 167804588
N-[3-(azepan-1-yl)-3-oxopropyl]-2,3-dihydroxy-4-methylbenzamide (PubChem CID 167804588) has the molecular formula C17H24N2O4 and a molecular weight of 320.39 g/mol. Its IUPAC name is N-[3-(azepan-1-yl)-3-oxopropyl]-2,3-dihydroxy-4-methylbenzamide.
| Compound Name | N-[3-(azepan-1-yl)-3-oxopropyl]-2,3-dihydroxy-4-methylbenzamide |
|---|---|
| PubChem CID | 167804588 |
| Molecular Formula | C17H24N2O4 |
| Molecular Weight | 320.39 g/mol |
| Exact Mass | 320.17 |
| IUPAC Name | N-[3-(azepan-1-yl)-3-oxopropyl]-2,3-dihydroxy-4-methylbenzamide |
| SMILES | Cc1ccc(C(=O)NCCC(=O)N2CCCCCC2)c(O)c1O |
| InChI | InChI=1S/C17H24N2O4/c1-12-6-7-13(16(22)15(12)21)17(23)18-9-8-14(20)19-10-4-2-3-5-11-19/h6-7,21-22H,2-5,8-11H2,1H3,(H,18,23) |
| InChIKey | OGOOMGHBAZEJQZ-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 89.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.39 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|