C14H18ClFN2 — CID 116913770
2-[(2-chloro-5-fluoro-4-methylphenyl)-(dimethylamino)methyl]butanenitrile (PubChem CID 116913770) has the molecular formula C14H18ClFN2 and a molecular weight of 268.76 g/mol. Its IUPAC name is 2-[(2-chloro-5-fluoro-4-methylphenyl)-(dimethylamino)methyl]butanenitrile.
| Compound Name | 2-[(2-chloro-5-fluoro-4-methylphenyl)-(dimethylamino)methyl]butanenitrile |
|---|---|
| PubChem CID | 116913770 |
| Molecular Formula | C14H18ClFN2 |
| Molecular Weight | 268.76 g/mol |
| Exact Mass | 268.11 |
| IUPAC Name | 2-[(2-chloro-5-fluoro-4-methylphenyl)-(dimethylamino)methyl]butanenitrile |
| SMILES | CCC(C#N)C(c1cc(F)c(C)cc1Cl)N(C)C |
| InChI | InChI=1S/C14H18ClFN2/c1-5-10(8-17)14(18(3)4)11-7-13(16)9(2)6-12(11)15/h6-7,10,14H,5H2,1-4H3 |
| InChIKey | IBGSETVFQGKDOM-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 27.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.76 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |