C13H14ClFN2 — CID 116958109
1-[(2-chloro-5-fluoro-4-methylphenyl)-(methylamino)methyl]cyclopropane-1-carbonitrile (PubChem CID 116958109) has the molecular formula C13H14ClFN2 and a molecular weight of 252.72 g/mol. Its IUPAC name is 1-[(2-chloro-5-fluoro-4-methylphenyl)-(methylamino)methyl]cyclopropane-1-carbonitrile.
| Compound Name | 1-[(2-chloro-5-fluoro-4-methylphenyl)-(methylamino)methyl]cyclopropane-1-carbonitrile |
|---|---|
| PubChem CID | 116958109 |
| Molecular Formula | C13H14ClFN2 |
| Molecular Weight | 252.72 g/mol |
| Exact Mass | 252.08 |
| IUPAC Name | 1-[(2-chloro-5-fluoro-4-methylphenyl)-(methylamino)methyl]cyclopropane-1-carbonitrile |
| SMILES | CNC(c1cc(F)c(C)cc1Cl)C1(C#N)CC1 |
| InChI | InChI=1S/C13H14ClFN2/c1-8-5-10(14)9(6-11(8)15)12(17-2)13(7-16)3-4-13/h5-6,12,17H,3-4H2,1-2H3 |
| InChIKey | FVZRLXHEZBHRJQ-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.72 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |