C24H21N5O4S — CID 11691405
2-[(E)-3-[4-[3-(dimethylamino)pyrazole-1-carbonyl]phenyl]-3-oxoprop-1-enyl]quinoline-6-sulfonamide (PubChem CID 11691405) has the molecular formula C24H21N5O4S and a molecular weight of 475.53 g/mol. Its IUPAC name is 2-[(E)-3-[4-[3-(dimethylamino)pyrazole-1-carbonyl]phenyl]-3-oxoprop-1-enyl]quinoline-6-sulfonamide.
| Compound Name | 2-[(E)-3-[4-[3-(dimethylamino)pyrazole-1-carbonyl]phenyl]-3-oxoprop-1-enyl]quinoline-6-sulfonamide |
|---|---|
| PubChem CID | 11691405 |
| Molecular Formula | C24H21N5O4S |
| Molecular Weight | 475.53 g/mol |
| Exact Mass | 475.13 |
| IUPAC Name | 2-[(E)-3-[4-[3-(dimethylamino)pyrazole-1-carbonyl]phenyl]-3-oxoprop-1-enyl]quinoline-6-sulfonamide |
| SMILES | CN(C)c1ccn(C(=O)c2ccc(C(=O)/C=C/c3ccc4cc(S(N)(=O)=O)ccc4n3)cc2)n1 |
| InChI | InChI=1S/C24H21N5O4S/c1-28(2)23-13-14-29(27-23)24(31)17-5-3-16(4-6-17)22(30)12-9-19-8-7-18-15-20(34(25,32)33)10-11-21(18)26-19/h3-15H,1-2H3,(H2,25,32,33)/b12-9+ |
| InChIKey | DDLQCHJDUXCCJB-FMIVXFBMSA-N |
| XLogP | 2.73 |
| TPSA | 128.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.53 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|