C13H21NO2 — CID 116914495
1-methoxy-1-(4-methoxy-2,3-dimethylphenyl)-N,N-dimethylmethanamine (PubChem CID 116914495) has the molecular formula C13H21NO2 and a molecular weight of 223.32 g/mol. Its IUPAC name is 1-methoxy-1-(4-methoxy-2,3-dimethylphenyl)-N,N-dimethylmethanamine.
| Compound Name | 1-methoxy-1-(4-methoxy-2,3-dimethylphenyl)-N,N-dimethylmethanamine |
|---|---|
| PubChem CID | 116914495 |
| Molecular Formula | C13H21NO2 |
| Molecular Weight | 223.32 g/mol |
| Exact Mass | 223.16 |
| IUPAC Name | 1-methoxy-1-(4-methoxy-2,3-dimethylphenyl)-N,N-dimethylmethanamine |
| SMILES | COc1ccc(C(OC)N(C)C)c(C)c1C |
| InChI | InChI=1S/C13H21NO2/c1-9-10(2)12(15-5)8-7-11(9)13(16-6)14(3)4/h7-8,13H,1-6H3 |
| InChIKey | CJPBLEXSBQTXRC-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.32 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|