C11H16O3 — CID 82281981
1-(4-methoxy-2,3-dimethylphenyl)ethane-1,2-diol (PubChem CID 82281981) has the molecular formula C11H16O3 and a molecular weight of 196.25 g/mol. Its IUPAC name is 1-(4-methoxy-2,3-dimethylphenyl)ethane-1,2-diol.
| Compound Name | 1-(4-methoxy-2,3-dimethylphenyl)ethane-1,2-diol |
|---|---|
| PubChem CID | 82281981 |
| Molecular Formula | C11H16O3 |
| Molecular Weight | 196.25 g/mol |
| Exact Mass | 196.11 |
| IUPAC Name | 1-(4-methoxy-2,3-dimethylphenyl)ethane-1,2-diol |
| SMILES | COc1ccc(C(O)CO)c(C)c1C |
| InChI | InChI=1S/C11H16O3/c1-7-8(2)11(14-3)5-4-9(7)10(13)6-12/h4-5,10,12-13H,6H2,1-3H3 |
| InChIKey | HACREYUILUQQKX-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.25 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |