C12H19NO3 — CID 117323942
1-(3,4-dimethoxy-2-methylphenyl)-2-(methylamino)ethanol (PubChem CID 117323942) has the molecular formula C12H19NO3 and a molecular weight of 225.29 g/mol. Its IUPAC name is 1-(3,4-dimethoxy-2-methylphenyl)-2-(methylamino)ethanol.
| Compound Name | 1-(3,4-dimethoxy-2-methylphenyl)-2-(methylamino)ethanol |
|---|---|
| PubChem CID | 117323942 |
| Molecular Formula | C12H19NO3 |
| Molecular Weight | 225.29 g/mol |
| Exact Mass | 225.14 |
| IUPAC Name | 1-(3,4-dimethoxy-2-methylphenyl)-2-(methylamino)ethanol |
| SMILES | CNCC(O)c1ccc(OC)c(OC)c1C |
| InChI | InChI=1S/C12H19NO3/c1-8-9(10(14)7-13-2)5-6-11(15-3)12(8)16-4/h5-6,10,13-14H,7H2,1-4H3 |
| InChIKey | LCYRXLURLKCHGF-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 50.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.29 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |