C11H16ClNO — CID 84783153
1-(3-chloro-2,4-dimethylphenyl)-2-(methylamino)ethanol (PubChem CID 84783153) has the molecular formula C11H16ClNO and a molecular weight of 213.71 g/mol. Its IUPAC name is 1-(3-chloro-2,4-dimethylphenyl)-2-(methylamino)ethanol.
| Compound Name | 1-(3-chloro-2,4-dimethylphenyl)-2-(methylamino)ethanol |
|---|---|
| PubChem CID | 84783153 |
| Molecular Formula | C11H16ClNO |
| Molecular Weight | 213.71 g/mol |
| Exact Mass | 213.09 |
| IUPAC Name | 1-(3-chloro-2,4-dimethylphenyl)-2-(methylamino)ethanol |
| SMILES | CNCC(O)c1ccc(C)c(Cl)c1C |
| InChI | InChI=1S/C11H16ClNO/c1-7-4-5-9(8(2)11(7)12)10(14)6-13-3/h4-5,10,13-14H,6H2,1-3H3 |
| InChIKey | SSMHBEBTSJIVND-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.71 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |