About 1-methoxy-N,N-dimethyl-1-(1-methylpiperidin-4-yl)methanamine
1-methoxy-N,N-dimethyl-1-(1-methylpiperidin-4-yl)methanamine (PubChem CID 116914570) has the molecular formula C10H22N2O
and a molecular weight of 186.30 g/mol. Its IUPAC name is 1-methoxy-N,N-dimethyl-1-(1-methylpiperidin-4-yl)methanamine.
Molecular Properties
| Compound Name | 1-methoxy-N,N-dimethyl-1-(1-methylpiperidin-4-yl)methanamine |
| PubChem CID | 116914570 |
| Molecular Formula | C10H22N2O |
| Molecular Weight | 186.30 g/mol |
| Exact Mass | 186.17 |
| IUPAC Name | 1-methoxy-N,N-dimethyl-1-(1-methylpiperidin-4-yl)methanamine |
| SMILES | COC(C1CCN(C)CC1)N(C)C |
| InChI | InChI=1S/C10H22N2O/c1-11(2)10(13-4)9-5-7-12(3)8-6-9/h9-10H,5-8H2,1-4H3 |
| InChIKey | BVPBZLKRIPEQSS-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.30 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 1-methoxy-N,N-dimethyl-1-(1-methylpiperidin-4-yl)methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methoxy-N,N-dimethyl-1-(1-methylpiperidin-4-yl)methanamine?
The IUPAC name of 1-methoxy-N,N-dimethyl-1-(1-methylpiperidin-4-yl)methanamine (CID 116914570) is 1-methoxy-N,N-dimethyl-1-(1-methylpiperidin-4-yl)methanamine.
What is the SMILES notation for 1-methoxy-N,N-dimethyl-1-(1-methylpiperidin-4-yl)methanamine?
The canonical SMILES for 1-methoxy-N,N-dimethyl-1-(1-methylpiperidin-4-yl)methanamine is COC(C1CCN(C)CC1)N(C)C.
What is the InChIKey of 1-methoxy-N,N-dimethyl-1-(1-methylpiperidin-4-yl)methanamine?
The InChIKey is BVPBZLKRIPEQSS-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H22N2O/c1-11(2)10(13-4)9-5-7-12(3)8-6-9/h9-10H,5-8H2,1-4H3.
What are the key properties of 1-methoxy-N,N-dimethyl-1-(1-methylpiperidin-4-yl)methanamine?
1-methoxy-N,N-dimethyl-1-(1-methylpiperidin-4-yl)methanamine has a molecular weight of 186.30 g/mol, XLogP of 0.86, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methoxy-N,N-dimethyl-1-(1-methylpiperidin-4-yl)methanamine is sourced from PubChem (CID 116914570), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).