C10H22N2O — CID 116914570
1-methoxy-N,N-dimethyl-1-(1-methylpiperidin-4-yl)methanamine (PubChem CID 116914570) has the molecular formula C10H22N2O and a molecular weight of 186.30 g/mol. Its IUPAC name is 1-methoxy-N,N-dimethyl-1-(1-methylpiperidin-4-yl)methanamine.
| Compound Name | 1-methoxy-N,N-dimethyl-1-(1-methylpiperidin-4-yl)methanamine |
|---|---|
| PubChem CID | 116914570 |
| Molecular Formula | C10H22N2O |
| Molecular Weight | 186.30 g/mol |
| Exact Mass | 186.17 |
| IUPAC Name | 1-methoxy-N,N-dimethyl-1-(1-methylpiperidin-4-yl)methanamine |
| SMILES | COC(C1CCN(C)CC1)N(C)C |
| InChI | InChI=1S/C10H22N2O/c1-11(2)10(13-4)9-5-7-12(3)8-6-9/h9-10H,5-8H2,1-4H3 |
| InChIKey | BVPBZLKRIPEQSS-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.30 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|