C11H16BrN — CID 116914675
1-(5-bromo-2-methylphenyl)-N,N-dimethylethanamine (PubChem CID 116914675) has the molecular formula C11H16BrN and a molecular weight of 242.16 g/mol. Its IUPAC name is 1-(5-bromo-2-methylphenyl)-N,N-dimethylethanamine.
| Compound Name | 1-(5-bromo-2-methylphenyl)-N,N-dimethylethanamine |
|---|---|
| PubChem CID | 116914675 |
| Molecular Formula | C11H16BrN |
| Molecular Weight | 242.16 g/mol |
| Exact Mass | 241.05 |
| IUPAC Name | 1-(5-bromo-2-methylphenyl)-N,N-dimethylethanamine |
| SMILES | Cc1ccc(Br)cc1C(C)N(C)C |
| InChI | InChI=1S/C11H16BrN/c1-8-5-6-10(12)7-11(8)9(2)13(3)4/h5-7,9H,1-4H3 |
| InChIKey | HIFCBXNVQVPELU-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.16 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |