C13H20BrN — CID 116964369
2-(5-bromo-2-methylphenyl)-N,3-dimethylbutan-1-amine (PubChem CID 116964369) has the molecular formula C13H20BrN and a molecular weight of 270.21 g/mol. Its IUPAC name is 2-(5-bromo-2-methylphenyl)-N,3-dimethylbutan-1-amine.
| Compound Name | 2-(5-bromo-2-methylphenyl)-N,3-dimethylbutan-1-amine |
|---|---|
| PubChem CID | 116964369 |
| Molecular Formula | C13H20BrN |
| Molecular Weight | 270.21 g/mol |
| Exact Mass | 269.08 |
| IUPAC Name | 2-(5-bromo-2-methylphenyl)-N,3-dimethylbutan-1-amine |
| SMILES | CNCC(c1cc(Br)ccc1C)C(C)C |
| InChI | InChI=1S/C13H20BrN/c1-9(2)13(8-15-4)12-7-11(14)6-5-10(12)3/h5-7,9,13,15H,8H2,1-4H3 |
| InChIKey | XBIRQTGCGHGZBI-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.21 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |