C12H17F2N — CID 83835356
2-(2,5-difluorophenyl)-N,3-dimethylbutan-1-amine (PubChem CID 83835356) has the molecular formula C12H17F2N and a molecular weight of 213.27 g/mol. Its IUPAC name is 2-(2,5-difluorophenyl)-N,3-dimethylbutan-1-amine.
| Compound Name | 2-(2,5-difluorophenyl)-N,3-dimethylbutan-1-amine |
|---|---|
| PubChem CID | 83835356 |
| Molecular Formula | C12H17F2N |
| Molecular Weight | 213.27 g/mol |
| Exact Mass | 213.13 |
| IUPAC Name | 2-(2,5-difluorophenyl)-N,3-dimethylbutan-1-amine |
| SMILES | CNCC(c1cc(F)ccc1F)C(C)C |
| InChI | InChI=1S/C12H17F2N/c1-8(2)11(7-15-3)10-6-9(13)4-5-12(10)14/h4-6,8,11,15H,7H2,1-3H3 |
| InChIKey | SLCOCFVCYBCUPX-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.27 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |