C13H20ClN — CID 116915181
1-(4-butan-2-ylphenyl)-1-chloro-N,N-dimethylmethanamine (PubChem CID 116915181) has the molecular formula C13H20ClN and a molecular weight of 225.76 g/mol. Its IUPAC name is 1-(4-butan-2-ylphenyl)-1-chloro-N,N-dimethylmethanamine.
| Compound Name | 1-(4-butan-2-ylphenyl)-1-chloro-N,N-dimethylmethanamine |
|---|---|
| PubChem CID | 116915181 |
| Molecular Formula | C13H20ClN |
| Molecular Weight | 225.76 g/mol |
| Exact Mass | 225.13 |
| IUPAC Name | 1-(4-butan-2-ylphenyl)-1-chloro-N,N-dimethylmethanamine |
| SMILES | CCC(C)c1ccc(C(Cl)N(C)C)cc1 |
| InChI | InChI=1S/C13H20ClN/c1-5-10(2)11-6-8-12(9-7-11)13(14)15(3)4/h6-10,13H,5H2,1-4H3 |
| InChIKey | OGZJORQNVAAMSM-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.76 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|