C13H17NO — CID 116917656
(3-aminocyclobutyl)-(2,5-dimethylphenyl)methanone (PubChem CID 116917656) has the molecular formula C13H17NO and a molecular weight of 203.29 g/mol. Its IUPAC name is (3-aminocyclobutyl)-(2,5-dimethylphenyl)methanone.
| Compound Name | (3-aminocyclobutyl)-(2,5-dimethylphenyl)methanone |
|---|---|
| PubChem CID | 116917656 |
| Molecular Formula | C13H17NO |
| Molecular Weight | 203.29 g/mol |
| Exact Mass | 203.13 |
| IUPAC Name | (3-aminocyclobutyl)-(2,5-dimethylphenyl)methanone |
| SMILES | Cc1ccc(C)c(C(=O)C2CC(N)C2)c1 |
| InChI | InChI=1S/C13H17NO/c1-8-3-4-9(2)12(5-8)13(15)10-6-11(14)7-10/h3-5,10-11H,6-7,14H2,1-2H3 |
| InChIKey | IKSSZBIKWVOVQV-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.29 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |