C16H21NO — CID 171944503
8-azabicyclo[3.2.1]octan-3-yl-(2,5-dimethylphenyl)methanone (PubChem CID 171944503) has the molecular formula C16H21NO and a molecular weight of 243.35 g/mol. Its IUPAC name is 8-azabicyclo[3.2.1]octan-3-yl-(2,5-dimethylphenyl)methanone.
| Compound Name | 8-azabicyclo[3.2.1]octan-3-yl-(2,5-dimethylphenyl)methanone |
|---|---|
| PubChem CID | 171944503 |
| Molecular Formula | C16H21NO |
| Molecular Weight | 243.35 g/mol |
| Exact Mass | 243.16 |
| IUPAC Name | 8-azabicyclo[3.2.1]octan-3-yl-(2,5-dimethylphenyl)methanone |
| SMILES | Cc1ccc(C)c(C(=O)C2CC3CCC(C2)N3)c1 |
| InChI | InChI=1S/C16H21NO/c1-10-3-4-11(2)15(7-10)16(18)12-8-13-5-6-14(9-12)17-13/h3-4,7,12-14,17H,5-6,8-9H2,1-2H3 |
| InChIKey | CTLWINUMDUOWPY-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.35 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |