2-amino-3-(2,3-dihydro-1-benzofuran-5-yl)-3-oxopropanoic acid

C11H11NO4 — CID 116920551

IUPAC2-amino-3-(2,3-dihydro-1-benzofuran-5-yl)-3-oxopropanoic acid
SMILESNC(C(=O)O)C(=O)c1ccc2c(c1)CCO2
InChIInChI=1S/C11H11NO4/c12-9(11(14)15)10(13)7-1-2-8-6(5-7)3-4-16-8/h1-2,5,9H,3-4,12H2,(H,14,15)
InChIKeyJWDHOWDTRFOIHF-UHFFFAOYSA-N
MW221.21 g/mol
LogP0.22
Rot. Bonds3

About 2-amino-3-(2,3-dihydro-1-benzofuran-5-yl)-3-oxopropanoic acid

2-amino-3-(2,3-dihydro-1-benzofuran-5-yl)-3-oxopropanoic acid (PubChem CID 116920551) has the molecular formula C11H11NO4 and a molecular weight of 221.21 g/mol. Its IUPAC name is 2-amino-3-(2,3-dihydro-1-benzofuran-5-yl)-3-oxopropanoic acid.

Molecular Properties

Compound Name2-amino-3-(2,3-dihydro-1-benzofuran-5-yl)-3-oxopropanoic acid
PubChem CID116920551
Molecular FormulaC11H11NO4
Molecular Weight221.21 g/mol
Exact Mass221.07
IUPAC Name2-amino-3-(2,3-dihydro-1-benzofuran-5-yl)-3-oxopropanoic acid
SMILESNC(C(=O)O)C(=O)c1ccc2c(c1)CCO2
InChIInChI=1S/C11H11NO4/c12-9(11(14)15)10(13)7-1-2-8-6(5-7)3-4-16-8/h1-2,5,9H,3-4,12H2,(H,14,15)
InChIKeyJWDHOWDTRFOIHF-UHFFFAOYSA-N
XLogP0.22
TPSA89.62 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500221.21
LogP ≤ 50.22
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}

Analyze 2-amino-3-(2,3-dihydro-1-benzofuran-5-yl)-3-oxopropanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-amino-3-(2,3-dihydro-1-benzofuran-5-yl)-3-oxopropanoic acid?
The IUPAC name of 2-amino-3-(2,3-dihydro-1-benzofuran-5-yl)-3-oxopropanoic acid (CID 116920551) is 2-amino-3-(2,3-dihydro-1-benzofuran-5-yl)-3-oxopropanoic acid.
What is the SMILES notation for 2-amino-3-(2,3-dihydro-1-benzofuran-5-yl)-3-oxopropanoic acid?
The canonical SMILES for 2-amino-3-(2,3-dihydro-1-benzofuran-5-yl)-3-oxopropanoic acid is NC(C(=O)O)C(=O)c1ccc2c(c1)CCO2.
What is the InChIKey of 2-amino-3-(2,3-dihydro-1-benzofuran-5-yl)-3-oxopropanoic acid?
The InChIKey is JWDHOWDTRFOIHF-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11NO4/c12-9(11(14)15)10(13)7-1-2-8-6(5-7)3-4-16-8/h1-2,5,9H,3-4,12H2,(H,14,15).
What are the key properties of 2-amino-3-(2,3-dihydro-1-benzofuran-5-yl)-3-oxopropanoic acid?
2-amino-3-(2,3-dihydro-1-benzofuran-5-yl)-3-oxopropanoic acid has a molecular weight of 221.21 g/mol, XLogP of 0.22, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-3-(2,3-dihydro-1-benzofuran-5-yl)-3-oxopropanoic acid is sourced from PubChem (CID 116920551), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).