C29H32N4O3S — CID 11692060
N-(3-aminopropyl)-4-[[[4-(2-methoxyphenyl)-1,3-thiazol-2-yl]-(2-phenoxyethyl)amino]methyl]benzamide (PubChem CID 11692060) has the molecular formula C29H32N4O3S and a molecular weight of 516.67 g/mol. Its IUPAC name is N-(3-aminopropyl)-4-[[[4-(2-methoxyphenyl)-1,3-thiazol-2-yl]-(2-phenoxyethyl)amino]methyl]benzamide.
| Compound Name | N-(3-aminopropyl)-4-[[[4-(2-methoxyphenyl)-1,3-thiazol-2-yl]-(2-phenoxyethyl)amino]methyl]benzamide |
|---|---|
| PubChem CID | 11692060 |
| Molecular Formula | C29H32N4O3S |
| Molecular Weight | 516.67 g/mol |
| Exact Mass | 516.22 |
| IUPAC Name | N-(3-aminopropyl)-4-[[[4-(2-methoxyphenyl)-1,3-thiazol-2-yl]-(2-phenoxyethyl)amino]methyl]benzamide |
| SMILES | COc1ccccc1-c1csc(N(CCOc2ccccc2)Cc2ccc(C(=O)NCCCN)cc2)n1 |
| InChI | InChI=1S/C29H32N4O3S/c1-35-27-11-6-5-10-25(27)26-21-37-29(32-26)33(18-19-36-24-8-3-2-4-9-24)20-22-12-14-23(15-13-22)28(34)31-17-7-16-30/h2-6,8-15,21H,7,16-20,30H2,1H3,(H,31,34) |
| InChIKey | XUTKZVXIDKTYGW-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 89.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.67 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|