C29H31N3O3S — CID 58675065
N-(2-methoxyethyl)-4-[[[4-(4-methylphenyl)-1,3-thiazol-2-yl]-(2-phenoxyethyl)amino]methyl]benzamide (PubChem CID 58675065) has the molecular formula C29H31N3O3S and a molecular weight of 501.65 g/mol. Its IUPAC name is N-(2-methoxyethyl)-4-[[[4-(4-methylphenyl)-1,3-thiazol-2-yl]-(2-phenoxyethyl)amino]methyl]benzamide.
| Compound Name | N-(2-methoxyethyl)-4-[[[4-(4-methylphenyl)-1,3-thiazol-2-yl]-(2-phenoxyethyl)amino]methyl]benzamide |
|---|---|
| PubChem CID | 58675065 |
| Molecular Formula | C29H31N3O3S |
| Molecular Weight | 501.65 g/mol |
| Exact Mass | 501.21 |
| IUPAC Name | N-(2-methoxyethyl)-4-[[[4-(4-methylphenyl)-1,3-thiazol-2-yl]-(2-phenoxyethyl)amino]methyl]benzamide |
| SMILES | COCCNC(=O)c1ccc(CN(CCOc2ccccc2)c2nc(-c3ccc(C)cc3)cs2)cc1 |
| InChI | InChI=1S/C29H31N3O3S/c1-22-8-12-24(13-9-22)27-21-36-29(31-27)32(17-19-35-26-6-4-3-5-7-26)20-23-10-14-25(15-11-23)28(33)30-16-18-34-2/h3-15,21H,16-20H2,1-2H3,(H,30,33) |
| InChIKey | CHWKWWIUJFPJPQ-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 63.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.65 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|