C13H15NO3 — CID 116923044
5-[2-(hydroxymethyl)butanoyl]-1,3-dihydroindol-2-one (PubChem CID 116923044) has the molecular formula C13H15NO3 and a molecular weight of 233.27 g/mol. Its IUPAC name is 5-[2-(hydroxymethyl)butanoyl]-1,3-dihydroindol-2-one.
| Compound Name | 5-[2-(hydroxymethyl)butanoyl]-1,3-dihydroindol-2-one |
|---|---|
| PubChem CID | 116923044 |
| Molecular Formula | C13H15NO3 |
| Molecular Weight | 233.27 g/mol |
| Exact Mass | 233.11 |
| IUPAC Name | 5-[2-(hydroxymethyl)butanoyl]-1,3-dihydroindol-2-one |
| SMILES | CCC(CO)C(=O)c1ccc2c(c1)CC(=O)N2 |
| InChI | InChI=1S/C13H15NO3/c1-2-8(7-15)13(17)9-3-4-11-10(5-9)6-12(16)14-11/h3-5,8,15H,2,6-7H2,1H3,(H,14,16) |
| InChIKey | HKIZKLJZQLGWNH-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.27 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |