C17H23NO2 — CID 82984767
6-(2-propylpentanoyl)-3,4-dihydro-1H-quinolin-2-one (PubChem CID 82984767) has the molecular formula C17H23NO2 and a molecular weight of 273.38 g/mol. Its IUPAC name is 6-(2-propylpentanoyl)-3,4-dihydro-1H-quinolin-2-one.
| Compound Name | 6-(2-propylpentanoyl)-3,4-dihydro-1H-quinolin-2-one |
|---|---|
| PubChem CID | 82984767 |
| Molecular Formula | C17H23NO2 |
| Molecular Weight | 273.38 g/mol |
| Exact Mass | 273.17 |
| IUPAC Name | 6-(2-propylpentanoyl)-3,4-dihydro-1H-quinolin-2-one |
| SMILES | CCCC(CCC)C(=O)c1ccc2c(c1)CCC(=O)N2 |
| InChI | InChI=1S/C17H23NO2/c1-3-5-12(6-4-2)17(20)14-7-9-15-13(11-14)8-10-16(19)18-15/h7,9,11-12H,3-6,8,10H2,1-2H3,(H,18,19) |
| InChIKey | IGMGJUVDJPCAJF-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.38 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |