C28H55NO7Si2 — CID 11692692
(3R,5S)-3,5-bis[(R)-[tert-butyl(dimethyl)silyl]oxy-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]methyl]pyrrolidin-2-one (PubChem CID 11692692) has the molecular formula C28H55NO7Si2 and a molecular weight of 573.92 g/mol. Its IUPAC name is (3R,5S)-3,5-bis[(R)-[tert-butyl(dimethyl)silyl]oxy-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]methyl]pyrrolidin-2-one.
| Compound Name | (3R,5S)-3,5-bis[(R)-[tert-butyl(dimethyl)silyl]oxy-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]methyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 11692692 |
| Molecular Formula | C28H55NO7Si2 |
| Molecular Weight | 573.92 g/mol |
| Exact Mass | 573.35 |
| IUPAC Name | (3R,5S)-3,5-bis[(R)-[tert-butyl(dimethyl)silyl]oxy-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]methyl]pyrrolidin-2-one |
| SMILES | CC1(C)OC[C@@H]([C@H](O[Si](C)(C)C(C)(C)C)[C@@H]2C[C@H]([C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]3COC(C)(C)O3)C(=O)N2)O1 |
| InChI | InChI=1S/C28H55NO7Si2/c1-25(2,3)37(11,12)35-22(20-16-31-27(7,8)33-20)18-15-19(29-24(18)30)23(21-17-32-28(9,10)34-21)36-38(13,14)26(4,5)6/h18-23H,15-17H2,1-14H3,(H,29,30)/t18-,19+,20+,21+,22-,23-/m1/s1 |
| InChIKey | XWKFGEBFKMPCDC-HFOLXAOLSA-N |
| XLogP | 5.57 |
| TPSA | 84.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.92 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|