C13H18N2O2 — CID 116931128
6-[2-(aminomethyl)-3-methylbutyl]-3H-1,3-benzoxazol-2-one (PubChem CID 116931128) has the molecular formula C13H18N2O2 and a molecular weight of 234.30 g/mol. Its IUPAC name is 6-[2-(aminomethyl)-3-methylbutyl]-3H-1,3-benzoxazol-2-one.
| Compound Name | 6-[2-(aminomethyl)-3-methylbutyl]-3H-1,3-benzoxazol-2-one |
|---|---|
| PubChem CID | 116931128 |
| Molecular Formula | C13H18N2O2 |
| Molecular Weight | 234.30 g/mol |
| Exact Mass | 234.14 |
| IUPAC Name | 6-[2-(aminomethyl)-3-methylbutyl]-3H-1,3-benzoxazol-2-one |
| SMILES | CC(C)C(CN)Cc1ccc2[nH]c(=O)oc2c1 |
| InChI | InChI=1S/C13H18N2O2/c1-8(2)10(7-14)5-9-3-4-11-12(6-9)17-13(16)15-11/h3-4,6,8,10H,5,7,14H2,1-2H3,(H,15,16) |
| InChIKey | JHLRNERSPSDSFY-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 72.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.30 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |