C11H14N4O3 — CID 116849572
2-amino-N'-methyl-3-(2-oxo-3H-1,3-benzoxazol-6-yl)propanehydrazide (PubChem CID 116849572) has the molecular formula C11H14N4O3 and a molecular weight of 250.26 g/mol. Its IUPAC name is 2-amino-N'-methyl-3-(2-oxo-3H-1,3-benzoxazol-6-yl)propanehydrazide.
| Compound Name | 2-amino-N'-methyl-3-(2-oxo-3H-1,3-benzoxazol-6-yl)propanehydrazide |
|---|---|
| PubChem CID | 116849572 |
| Molecular Formula | C11H14N4O3 |
| Molecular Weight | 250.26 g/mol |
| Exact Mass | 250.11 |
| IUPAC Name | 2-amino-N'-methyl-3-(2-oxo-3H-1,3-benzoxazol-6-yl)propanehydrazide |
| SMILES | CNNC(=O)C(N)Cc1ccc2[nH]c(=O)oc2c1 |
| InChI | InChI=1S/C11H14N4O3/c1-13-15-10(16)7(12)4-6-2-3-8-9(5-6)18-11(17)14-8/h2-3,5,7,13H,4,12H2,1H3,(H,14,17)(H,15,16) |
| InChIKey | UTRIRXMOCVPIHM-UHFFFAOYSA-N |
| XLogP | -0.76 |
| TPSA | 113.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.26 |
| LogP ≤ 5 | -0.76 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|